C32H20N2O11 — CID 170852107
benzene-1,3-dicarboxylic acid;1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene (PubChem CID 170852107) has the molecular formula C32H20N2O11 and a molecular weight of 608.52 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene.
| Compound Name | benzene-1,3-dicarboxylic acid;1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
|---|---|
| PubChem CID | 170852107 |
| Molecular Formula | C32H20N2O11 |
| Molecular Weight | 608.52 g/mol |
| Exact Mass | 608.11 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;1,3-dioxo-2-benzofuran-5-carboxylic acid;1-isocyanato-4-[(4-isocyanatophenyl)methyl]benzene |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)OC2=O.O=C(O)c1cccc(C(=O)O)c1.O=C=Nc1ccc(Cc2ccc(N=C=O)cc2)cc1 |
| InChI | InChI=1S/C15H10N2O2.C9H4O5.C8H6O4/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;9-7(10)5-2-1-3-6(4-5)8(11)12/h1-8H,9H2;1-3H,(H,10,11);1-4H,(H,9,10)(H,11,12) |
| InChIKey | VHEYZOSMGUSXIX-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 214.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|