About furan-2,5-dione;2-methyloxirane;oxirane
furan-2,5-dione;2-methyloxirane;oxirane (PubChem CID 170852253) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is furan-2,5-dione;2-methyloxirane;oxirane.
Molecular Properties
| Compound Name | furan-2,5-dione;2-methyloxirane;oxirane |
| PubChem CID | 170852253 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | furan-2,5-dione;2-methyloxirane;oxirane |
| SMILES | C1CO1.CC1CO1.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C4H2O3.C3H6O.C2H4O/c5-3-1-2-4(6)7-3;1-3-2-4-3;1-2-3-1/h1-2H;3H,2H2,1H3;1-2H2 |
| InChIKey | CMFNHXOUYSVQTB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze furan-2,5-dione;2-methyloxirane;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2,5-dione;2-methyloxirane;oxirane?
The IUPAC name of furan-2,5-dione;2-methyloxirane;oxirane (CID 170852253) is furan-2,5-dione;2-methyloxirane;oxirane.
What is the SMILES notation for furan-2,5-dione;2-methyloxirane;oxirane?
The canonical SMILES for furan-2,5-dione;2-methyloxirane;oxirane is C1CO1.CC1CO1.O=C1C=CC(=O)O1.
What is the InChIKey of furan-2,5-dione;2-methyloxirane;oxirane?
The InChIKey is CMFNHXOUYSVQTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2O3.C3H6O.C2H4O/c5-3-1-2-4(6)7-3;1-3-2-4-3;1-2-3-1/h1-2H;3H,2H2,1H3;1-2H2.
What are the key properties of furan-2,5-dione;2-methyloxirane;oxirane?
furan-2,5-dione;2-methyloxirane;oxirane has a molecular weight of 200.19 g/mol, XLogP of 0.05, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2,5-dione;2-methyloxirane;oxirane is sourced from PubChem (CID 170852253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).