About [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate
[3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate (PubChem CID 170852435) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate |
| PubChem CID | 170852435 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.NCc1cccc(CN)c1 |
| InChI | InChI=1S/C8H12N2.C5H8O2/c9-5-7-2-1-3-8(4-7)6-10;1-4(2)5(6)7-3/h1-4H,5-6,9-10H2;1H2,2-3H3 |
| InChIKey | AOVUHOUCVNRWTI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate?
The IUPAC name of [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate (CID 170852435) is [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate.
What is the SMILES notation for [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate?
The canonical SMILES for [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.NCc1cccc(CN)c1.
What is the InChIKey of [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate?
The InChIKey is AOVUHOUCVNRWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.C5H8O2/c9-5-7-2-1-3-8(4-7)6-10;1-4(2)5(6)7-3/h1-4H,5-6,9-10H2;1H2,2-3H3.
What are the key properties of [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate?
[3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate has a molecular weight of 236.31 g/mol, XLogP of 1.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(aminomethyl)phenyl]methanamine;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 170852435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).