About dihydroxy(dimethyl)silane;trimethoxy(methyl)silane
dihydroxy(dimethyl)silane;trimethoxy(methyl)silane (PubChem CID 170852820) has the molecular formula C6H20O5Si2
and a molecular weight of 228.39 g/mol. Its IUPAC name is dihydroxy(dimethyl)silane;trimethoxy(methyl)silane.
Molecular Properties
| Compound Name | dihydroxy(dimethyl)silane;trimethoxy(methyl)silane |
| PubChem CID | 170852820 |
| Molecular Formula | C6H20O5Si2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | dihydroxy(dimethyl)silane;trimethoxy(methyl)silane |
| SMILES | CO[Si](C)(OC)OC.C[Si](C)(O)O |
| InChI | InChI=1S/C4H12O3Si.C2H8O2Si/c1-5-8(4,6-2)7-3;1-5(2,3)4/h1-4H3;3-4H,1-2H3 |
| InChIKey | XVABUXZYHBJHIW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(dimethyl)silane;trimethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(dimethyl)silane;trimethoxy(methyl)silane?
The IUPAC name of dihydroxy(dimethyl)silane;trimethoxy(methyl)silane (CID 170852820) is dihydroxy(dimethyl)silane;trimethoxy(methyl)silane.
What is the SMILES notation for dihydroxy(dimethyl)silane;trimethoxy(methyl)silane?
The canonical SMILES for dihydroxy(dimethyl)silane;trimethoxy(methyl)silane is CO[Si](C)(OC)OC.C[Si](C)(O)O.
What is the InChIKey of dihydroxy(dimethyl)silane;trimethoxy(methyl)silane?
The InChIKey is XVABUXZYHBJHIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12O3Si.C2H8O2Si/c1-5-8(4,6-2)7-3;1-5(2,3)4/h1-4H3;3-4H,1-2H3.
What are the key properties of dihydroxy(dimethyl)silane;trimethoxy(methyl)silane?
dihydroxy(dimethyl)silane;trimethoxy(methyl)silane has a molecular weight of 228.39 g/mol, XLogP of 0.17, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(dimethyl)silane;trimethoxy(methyl)silane is sourced from PubChem (CID 170852820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).