About butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane
butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane (PubChem CID 170852981) has the molecular formula C25H42N2O8
and a molecular weight of 498.62 g/mol. Its IUPAC name is butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane.
Molecular Properties
| Compound Name | butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane |
| PubChem CID | 170852981 |
| Molecular Formula | C25H42N2O8 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane |
| SMILES | O=C(O)CCCCC(=O)O.O=C=NC1CCC(CC2CCC(N=C=O)CC2)CC1.OCCCCO |
| InChI | InChI=1S/C15H22N2O2.C6H10O4.C4H10O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;7-5(8)3-1-2-4-6(9)10;5-3-1-2-4-6/h12-15H,1-9H2;1-4H2,(H,7,8)(H,9,10);5-6H,1-4H2 |
| InChIKey | GRZSMXMBTSHECJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 173.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane?
The IUPAC name of butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane (CID 170852981) is butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane.
What is the SMILES notation for butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane?
The canonical SMILES for butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane is O=C(O)CCCCC(=O)O.O=C=NC1CCC(CC2CCC(N=C=O)CC2)CC1.OCCCCO.
What is the InChIKey of butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane?
The InChIKey is GRZSMXMBTSHECJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2.C6H10O4.C4H10O2/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;7-5(8)3-1-2-4-6(9)10;5-3-1-2-4-6/h12-15H,1-9H2;1-4H2,(H,7,8)(H,9,10);5-6H,1-4H2.
What are the key properties of butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane?
butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane has a molecular weight of 498.62 g/mol, XLogP of 3.63, 12 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,4-diol;hexanedioic acid;1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane is sourced from PubChem (CID 170852981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).