C11H15N5O2 — CID 170853019
formaldehyde;methanol;6-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 170853019) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is formaldehyde;methanol;6-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | formaldehyde;methanol;6-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 170853019 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | formaldehyde;methanol;6-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=O.CO.Nc1nc(N)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H9N5.CH4O.CH2O/c10-8-12-7(13-9(11)14-8)6-4-2-1-3-5-6;2*1-2/h1-5H,(H4,10,11,12,13,14);2H,1H3;1H2 |
| InChIKey | RTEDYGYFZJKWQD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 128.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |