About dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride
dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride (PubChem CID 170853255) has the molecular formula C12H20ClNO4
and a molecular weight of 277.75 g/mol. Its IUPAC name is dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride |
| PubChem CID | 170853255 |
| Molecular Formula | C12H20ClNO4 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride |
| SMILES | C=CC[N+](C)(C)CC=C.Cl.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C8H16N.C4H4O4.ClH/c1-5-7-9(3,4)8-6-2;5-3(6)1-2-4(7)8;/h5-6H,1-2,7-8H2,3-4H3;1-2H,(H,5,6)(H,7,8);1H/q+1;;/p-1/b;2-1-; |
| InChIKey | FQJYBUKUSKVJOA-FJOGWHKWSA-M |
| XLogP | 0.23 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride?
The IUPAC name of dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride (CID 170853255) is dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride.
What is the SMILES notation for dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride?
The canonical SMILES for dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride is C=CC[N+](C)(C)CC=C.Cl.O=C([O-])/C=C\C(=O)O.
What is the InChIKey of dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride?
The InChIKey is FQJYBUKUSKVJOA-FJOGWHKWSA-M. The full InChI is InChI=1S/C8H16N.C4H4O4.ClH/c1-5-7-9(3,4)8-6-2;5-3(6)1-2-4(7)8;/h5-6H,1-2,7-8H2,3-4H3;1-2H,(H,5,6)(H,7,8);1H/q+1;;/p-1/b;2-1-;.
What are the key properties of dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride?
dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride has a molecular weight of 277.75 g/mol, XLogP of 0.23, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(prop-2-enyl)azanium;(Z)-4-hydroxy-4-oxobut-2-enoate;hydrochloride is sourced from PubChem (CID 170853255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).