About CID 170853657
CID 170853657 (PubChem CID 170853657) has the molecular formula C18H14N4Na2O8S2
and a molecular weight of 524.44 g/mol.
Molecular Properties
| Compound Name | CID 170853657 |
| PubChem CID | 170853657 |
| Molecular Formula | C18H14N4Na2O8S2 |
| Molecular Weight | 524.44 g/mol |
| Exact Mass | 524.00 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)c1cccc(/N=N/c2cc(/N=N/c3cccc(S(=O)(=O)O)c3)c(O)cc2O)c1.[Na].[Na] |
| InChI | InChI=1S/C18H14N4O8S2.2Na/c23-17-10-18(24)16(22-20-12-4-2-6-14(8-12)32(28,29)30)9-15(17)21-19-11-3-1-5-13(7-11)31(25,26)27;;/h1-10,23-24H,(H,25,26,27)(H,28,29,30);;/b21-19+,22-20+;; |
| InChIKey | PJHOSUYAELYHSK-JXYRNBIZSA-N |
| XLogP | 3.66 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 170853657 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170853657?
The IUPAC name of CID 170853657 (CID 170853657) is not available.
What is the SMILES notation for CID 170853657?
The canonical SMILES for CID 170853657 is O=S(=O)(O)c1cccc(/N=N/c2cc(/N=N/c3cccc(S(=O)(=O)O)c3)c(O)cc2O)c1.[Na].[Na].
What is the InChIKey of CID 170853657?
The InChIKey is PJHOSUYAELYHSK-JXYRNBIZSA-N. The full InChI is InChI=1S/C18H14N4O8S2.2Na/c23-17-10-18(24)16(22-20-12-4-2-6-14(8-12)32(28,29)30)9-15(17)21-19-11-3-1-5-13(7-11)31(25,26)27;;/h1-10,23-24H,(H,25,26,27)(H,28,29,30);;/b21-19+,22-20+;;.
What are the key properties of CID 170853657?
CID 170853657 has a molecular weight of 524.44 g/mol, XLogP of 3.66, 6 rotatable bonds, 4 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170853657 is sourced from PubChem (CID 170853657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).