C30H53ClN2O2 — CID 170853835
(Z,12R)-N-[3-[benzyl(dimethyl)azaniumyl]propyl]-12-hydroxyoctadec-9-enimidate;hydrochloride (PubChem CID 170853835) has the molecular formula C30H53ClN2O2 and a molecular weight of 509.22 g/mol. Its IUPAC name is (Z,12R)-N-[3-[benzyl(dimethyl)azaniumyl]propyl]-12-hydroxyoctadec-9-enimidate;hydrochloride.
| Compound Name | (Z,12R)-N-[3-[benzyl(dimethyl)azaniumyl]propyl]-12-hydroxyoctadec-9-enimidate;hydrochloride |
|---|---|
| PubChem CID | 170853835 |
| Molecular Formula | C30H53ClN2O2 |
| Molecular Weight | 509.22 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | (Z,12R)-N-[3-[benzyl(dimethyl)azaniumyl]propyl]-12-hydroxyoctadec-9-enimidate;hydrochloride |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCC/C([O-])=N/CCC[N+](C)(C)Cc1ccccc1.Cl |
| InChI | InChI=1S/C30H52N2O2.ClH/c1-4-5-6-16-22-29(33)23-17-11-9-7-8-10-12-18-24-30(34)31-25-19-26-32(2,3)27-28-20-14-13-15-21-28;/h11,13-15,17,20-21,29,33H,4-10,12,16,18-19,22-27H2,1-3H3;1H/b17-11-;/t29-;/m1./s1 |
| InChIKey | WOCCXUPQKZYAIW-QPVZQWBHSA-N |
| XLogP | 6.84 |
| TPSA | 55.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.22 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|