About 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid (PubChem CID 17085408) has the molecular formula C7H5N7O3S
and a molecular weight of 267.23 g/mol. Its IUPAC name is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid |
| PubChem CID | 17085408 |
| Molecular Formula | C7H5N7O3S |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.02 |
| IUPAC Name | 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid |
| SMILES | N#CSCc1c(C(=O)O)nnn1-c1nonc1N |
| InChI | InChI=1S/C7H5N7O3S/c8-2-18-1-3-4(7(15)16)10-13-14(3)6-5(9)11-17-12-6/h1H2,(H2,9,11)(H,15,16) |
| InChIKey | XQHATPQVLRXRDM-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid?
The IUPAC name of 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid (CID 17085408) is 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid.
What is the SMILES notation for 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid?
The canonical SMILES for 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid is N#CSCc1c(C(=O)O)nnn1-c1nonc1N.
What is the InChIKey of 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid?
The InChIKey is XQHATPQVLRXRDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N7O3S/c8-2-18-1-3-4(7(15)16)10-13-14(3)6-5(9)11-17-12-6/h1H2,(H2,9,11)(H,15,16).
What are the key properties of 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid?
1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid has a molecular weight of 267.23 g/mol, XLogP of -0.36, 4 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-1,2,5-oxadiazol-3-yl)-5-(thiocyanatomethyl)triazole-4-carboxylic acid is sourced from PubChem (CID 17085408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).