C41H44N5O2S+ — CID 170854398
thiocyanic acid;N-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-2-[2-[2-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]phenoxy]ethoxy]aniline (PubChem CID 170854398) has the molecular formula C41H44N5O2S+ and a molecular weight of 670.90 g/mol. Its IUPAC name is thiocyanic acid;N-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-2-[2-[2-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]phenoxy]ethoxy]aniline.
| Compound Name | thiocyanic acid;N-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-2-[2-[2-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]phenoxy]ethoxy]aniline |
|---|---|
| PubChem CID | 170854398 |
| Molecular Formula | C41H44N5O2S+ |
| Molecular Weight | 670.90 g/mol |
| Exact Mass | 670.32 |
| IUPAC Name | thiocyanic acid;N-[2-(1,3,3-trimethylindol-1-ium-2-yl)ethenyl]-2-[2-[2-[2-(1,3,3-trimethylindol-2-ylidene)ethylideneamino]phenoxy]ethoxy]aniline |
| SMILES | CN1C(=C/C=N/c2ccccc2OCCOc2ccccc2NC=CC2=[N+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.N#CS |
| InChI | InChI=1S/C40H42N4O2.CHNS/c1-39(2)29-15-7-11-19-33(29)43(5)37(39)23-25-41-31-17-9-13-21-35(31)45-27-28-46-36-22-14-10-18-32(36)42-26-24-38-40(3,4)30-16-8-12-20-34(30)44(38)6;2-1-3/h7-26H,27-28H2,1-6H3;3H/p+1/b37-23?,41-25+; |
| InChIKey | HUVQHRPIORMQBE-RMMYBJEGSA-O |
| XLogP | 9.19 |
| TPSA | 72.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.90 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|