C4H7N9 — CID 170854691
2-hydrazinyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine (PubChem CID 170854691) has the molecular formula C4H7N9 and a molecular weight of 181.16 g/mol. Its IUPAC name is 2-hydrazinyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine.
| Compound Name | 2-hydrazinyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
|---|---|
| PubChem CID | 170854691 |
| Molecular Formula | C4H7N9 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | 2-hydrazinyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-5,7-diamine |
| SMILES | NNc1nc2nc(N)nc(N)n2n1 |
| InChI | InChI=1S/C4H7N9/c5-1-8-2(6)13-4(9-1)10-3(11-7)12-13/h7H2,(H5,5,6,8,9,10,11,12) |
| InChIKey | GBQJXQNMBOLRQO-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 146.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|