C5H7N7 — CID 170854711
(5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-yl)hydrazine (PubChem CID 170854711) has the molecular formula C5H7N7 and a molecular weight of 165.16 g/mol. Its IUPAC name is (5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-yl)hydrazine.
| Compound Name | (5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-yl)hydrazine |
|---|---|
| PubChem CID | 170854711 |
| Molecular Formula | C5H7N7 |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (5-methyl-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-yl)hydrazine |
| SMILES | Cc1ncn2nc(NN)nc2n1 |
| InChI | InChI=1S/C5H7N7/c1-3-7-2-12-5(8-3)9-4(10-6)11-12/h2H,6H2,1H3,(H,10,11) |
| InChIKey | IMMWINNAQWATAN-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|