C23H40N2O2S — CID 170854798
(E)-6-[dimethyl(oxo)-λ6-sulfanylidene]-9,9-dimethyl-4,4-dipropyl-7-pyrazol-1-yldec-7-en-5-one (PubChem CID 170854798) has the molecular formula C23H40N2O2S and a molecular weight of 408.65 g/mol. Its IUPAC name is (E)-6-[dimethyl(oxo)-λ6-sulfanylidene]-9,9-dimethyl-4,4-dipropyl-7-pyrazol-1-yldec-7-en-5-one.
| Compound Name | (E)-6-[dimethyl(oxo)-λ6-sulfanylidene]-9,9-dimethyl-4,4-dipropyl-7-pyrazol-1-yldec-7-en-5-one |
|---|---|
| PubChem CID | 170854798 |
| Molecular Formula | C23H40N2O2S |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | (E)-6-[dimethyl(oxo)-λ6-sulfanylidene]-9,9-dimethyl-4,4-dipropyl-7-pyrazol-1-yldec-7-en-5-one |
| SMILES | CCCC(CCC)(CCC)C(=O)C(/C(=C\C(C)(C)C)n1cccn1)=S(C)(C)=O |
| InChI | InChI=1S/C23H40N2O2S/c1-9-13-23(14-10-2,15-11-3)21(26)20(28(7,8)27)19(18-22(4,5)6)25-17-12-16-24-25/h12,16-18H,9-11,13-15H2,1-8H3/b19-18+ |
| InChIKey | PDRZEVKMMIPJQG-VHEBQXMUSA-N |
| XLogP | 5.44 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|