C7H12N4O2 — CID 17085488
4-amino-N,N-diethyl-1,2,5-oxadiazole-3-carboxamide (PubChem CID 17085488) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is 4-amino-N,N-diethyl-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N,N-diethyl-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 17085488 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4-amino-N,N-diethyl-1,2,5-oxadiazole-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1nonc1N |
| InChI | InChI=1S/C7H12N4O2/c1-3-11(4-2)7(12)5-6(8)10-13-9-5/h3-4H2,1-2H3,(H2,8,10) |
| InChIKey | MGMPBVNTZODUKS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |