C25H40O4 — CID 170855308
(3E,5Z,7Z)-6-acetyl-8-[(2R,3R,5S)-5-[(2S,4S)-2,4-dimethylhexyl]-3-methyloxan-2-yl]nona-3,5,7-trienoic acid (PubChem CID 170855308) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (3E,5Z,7Z)-6-acetyl-8-[(2R,3R,5S)-5-[(2S,4S)-2,4-dimethylhexyl]-3-methyloxan-2-yl]nona-3,5,7-trienoic acid.
| Compound Name | (3E,5Z,7Z)-6-acetyl-8-[(2R,3R,5S)-5-[(2S,4S)-2,4-dimethylhexyl]-3-methyloxan-2-yl]nona-3,5,7-trienoic acid |
|---|---|
| PubChem CID | 170855308 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (3E,5Z,7Z)-6-acetyl-8-[(2R,3R,5S)-5-[(2S,4S)-2,4-dimethylhexyl]-3-methyloxan-2-yl]nona-3,5,7-trienoic acid |
| SMILES | CC[C@H](C)C[C@H](C)C[C@@H]1CO[C@@H](/C(C)=C\C(=C\C=C\CC(=O)O)C(C)=O)[C@H](C)C1 |
| InChI | InChI=1S/C25H40O4/c1-7-17(2)12-18(3)13-22-14-19(4)25(29-16-22)20(5)15-23(21(6)26)10-8-9-11-24(27)28/h8-10,15,17-19,22,25H,7,11-14,16H2,1-6H3,(H,27,28)/b9-8+,20-15-,23-10-/t17-,18-,19+,22-,25+/m0/s1 |
| InChIKey | KEYKZJDXTRWBNM-XQTQFBPRSA-N |
| XLogP | 5.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|