C26H29N7O4S — CID 170855613
4-(4-cyano-2,6-dimethylphenoxy)-2-[[1-[4-(methanesulfonamido)phenyl]piperidin-4-yl]amino]pyrimidine-5-carboxamide (PubChem CID 170855613) has the molecular formula C26H29N7O4S and a molecular weight of 535.63 g/mol. Its IUPAC name is 4-(4-cyano-2,6-dimethylphenoxy)-2-[[1-[4-(methanesulfonamido)phenyl]piperidin-4-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | 4-(4-cyano-2,6-dimethylphenoxy)-2-[[1-[4-(methanesulfonamido)phenyl]piperidin-4-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 170855613 |
| Molecular Formula | C26H29N7O4S |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 4-(4-cyano-2,6-dimethylphenoxy)-2-[[1-[4-(methanesulfonamido)phenyl]piperidin-4-yl]amino]pyrimidine-5-carboxamide |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1nc(NC2CCN(c3ccc(NS(C)(=O)=O)cc3)CC2)ncc1C(N)=O |
| InChI | InChI=1S/C26H29N7O4S/c1-16-12-18(14-27)13-17(2)23(16)37-25-22(24(28)34)15-29-26(31-25)30-19-8-10-33(11-9-19)21-6-4-20(5-7-21)32-38(3,35)36/h4-7,12-13,15,19,32H,8-11H2,1-3H3,(H2,28,34)(H,29,30,31) |
| InChIKey | VXQZSRNBYWNPNH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|