3,5-bis(1-methyltriazol-4-yl)benzoic acid

C13H12N6O2 — CID 170855649

IUPAC3,5-bis(1-methyltriazol-4-yl)benzoic acid
SMILESCn1cc(-c2cc(C(=O)O)cc(-c3cn(C)nn3)c2)nn1
InChIInChI=1S/C13H12N6O2/c1-18-6-11(14-16-18)8-3-9(5-10(4-8)13(20)21)12-7-19(2)17-15-12/h3-7H,1-2H3,(H,20,21)
InChIKeyPDMVDNGDJJRIED-UHFFFAOYSA-N
MW284.28 g/mol
LogP0.98
Rot. Bonds3

About 3,5-bis(1-methyltriazol-4-yl)benzoic acid

3,5-bis(1-methyltriazol-4-yl)benzoic acid (PubChem CID 170855649) has the molecular formula C13H12N6O2 and a molecular weight of 284.28 g/mol. Its IUPAC name is 3,5-bis(1-methyltriazol-4-yl)benzoic acid.

Molecular Properties

Compound Name3,5-bis(1-methyltriazol-4-yl)benzoic acid
PubChem CID170855649
Molecular FormulaC13H12N6O2
Molecular Weight284.28 g/mol
Exact Mass284.10
IUPAC Name3,5-bis(1-methyltriazol-4-yl)benzoic acid
SMILESCn1cc(-c2cc(C(=O)O)cc(-c3cn(C)nn3)c2)nn1
InChIInChI=1S/C13H12N6O2/c1-18-6-11(14-16-18)8-3-9(5-10(4-8)13(20)21)12-7-19(2)17-15-12/h3-7H,1-2H3,(H,20,21)
InChIKeyPDMVDNGDJJRIED-UHFFFAOYSA-N
XLogP0.98
TPSA98.72 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.28
LogP ≤ 50.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Analyze 3,5-bis(1-methyltriazol-4-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis(1-methyltriazol-4-yl)benzoic acid?
The IUPAC name of 3,5-bis(1-methyltriazol-4-yl)benzoic acid (CID 170855649) is 3,5-bis(1-methyltriazol-4-yl)benzoic acid.
What is the SMILES notation for 3,5-bis(1-methyltriazol-4-yl)benzoic acid?
The canonical SMILES for 3,5-bis(1-methyltriazol-4-yl)benzoic acid is Cn1cc(-c2cc(C(=O)O)cc(-c3cn(C)nn3)c2)nn1.
What is the InChIKey of 3,5-bis(1-methyltriazol-4-yl)benzoic acid?
The InChIKey is PDMVDNGDJJRIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N6O2/c1-18-6-11(14-16-18)8-3-9(5-10(4-8)13(20)21)12-7-19(2)17-15-12/h3-7H,1-2H3,(H,20,21).
What are the key properties of 3,5-bis(1-methyltriazol-4-yl)benzoic acid?
3,5-bis(1-methyltriazol-4-yl)benzoic acid has a molecular weight of 284.28 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(1-methyltriazol-4-yl)benzoic acid is sourced from PubChem (CID 170855649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).