About 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide
6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide (PubChem CID 170856008) has the molecular formula C13H14N4O2
and a molecular weight of 258.28 g/mol. Its IUPAC name is 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide.
Molecular Properties
| Compound Name | 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide |
| PubChem CID | 170856008 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide |
| SMILES | Cc1cccc(Oc2cncc(/C(N)=N/O)n2)c1C |
| InChI | InChI=1S/C13H14N4O2/c1-8-4-3-5-11(9(8)2)19-12-7-15-6-10(16-12)13(14)17-18/h3-7,18H,1-2H3,(H2,14,17) |
| InChIKey | LCAQWWWEOIUSAO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide?
The IUPAC name of 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide (CID 170856008) is 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide.
What is the SMILES notation for 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide?
The canonical SMILES for 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide is Cc1cccc(Oc2cncc(/C(N)=N/O)n2)c1C.
What is the InChIKey of 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide?
The InChIKey is LCAQWWWEOIUSAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O2/c1-8-4-3-5-11(9(8)2)19-12-7-15-6-10(16-12)13(14)17-18/h3-7,18H,1-2H3,(H2,14,17).
What are the key properties of 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide?
6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide has a molecular weight of 258.28 g/mol, XLogP of 1.98, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dimethylphenoxy)-N'-hydroxypyrazine-2-carboximidamide is sourced from PubChem (CID 170856008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).