C21H21FN6 — CID 170856365
N-[(E)-(3-fluorophenyl)methylideneamino]-6-(4-phenylpiperazin-1-yl)pyridazin-3-amine (PubChem CID 170856365) has the molecular formula C21H21FN6 and a molecular weight of 376.44 g/mol. Its IUPAC name is N-[(E)-(3-fluorophenyl)methylideneamino]-6-(4-phenylpiperazin-1-yl)pyridazin-3-amine.
| Compound Name | N-[(E)-(3-fluorophenyl)methylideneamino]-6-(4-phenylpiperazin-1-yl)pyridazin-3-amine |
|---|---|
| PubChem CID | 170856365 |
| Molecular Formula | C21H21FN6 |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[(E)-(3-fluorophenyl)methylideneamino]-6-(4-phenylpiperazin-1-yl)pyridazin-3-amine |
| SMILES | Fc1cccc(/C=N/Nc2ccc(N3CCN(c4ccccc4)CC3)nn2)c1 |
| InChI | InChI=1S/C21H21FN6/c22-18-6-4-5-17(15-18)16-23-24-20-9-10-21(26-25-20)28-13-11-27(12-14-28)19-7-2-1-3-8-19/h1-10,15-16H,11-14H2,(H,24,25)/b23-16+ |
| InChIKey | DQQLTYURSRFYGL-XQNSMLJCSA-N |
| XLogP | 3.39 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|