About (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea
(3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea (PubChem CID 170856386) has the molecular formula C12H9Cl2N5OS
and a molecular weight of 342.21 g/mol. Its IUPAC name is (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea.
Molecular Properties
| Compound Name | (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea |
| PubChem CID | 170856386 |
| Molecular Formula | C12H9Cl2N5OS |
| Molecular Weight | 342.21 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea |
| SMILES | ON/C(=N\C(=S)Nc1ccc(Cl)cc1Cl)c1cnccn1 |
| InChI | InChI=1S/C12H9Cl2N5OS/c13-7-1-2-9(8(14)5-7)17-12(21)18-11(19-20)10-6-15-3-4-16-10/h1-6,20H,(H2,17,18,19,21) |
| InChIKey | IWTHLKORLVREHE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.21 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea?
The IUPAC name of (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea (CID 170856386) is (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea.
What is the SMILES notation for (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea?
The canonical SMILES for (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea is ON/C(=N\C(=S)Nc1ccc(Cl)cc1Cl)c1cnccn1.
What is the InChIKey of (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea?
The InChIKey is IWTHLKORLVREHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2N5OS/c13-7-1-2-9(8(14)5-7)17-12(21)18-11(19-20)10-6-15-3-4-16-10/h1-6,20H,(H2,17,18,19,21).
What are the key properties of (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea?
(3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea has a molecular weight of 342.21 g/mol, XLogP of 2.91, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-1-(2,4-dichlorophenyl)-3-[(hydroxyamino)-pyrazin-2-ylmethylidene]thiourea is sourced from PubChem (CID 170856386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).