C20H24N4 — CID 170856544
N'-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]quinoline-2-carboximidamide (PubChem CID 170856544) has the molecular formula C20H24N4 and a molecular weight of 320.44 g/mol. Its IUPAC name is N'-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]quinoline-2-carboximidamide.
| Compound Name | N'-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 170856544 |
| Molecular Formula | C20H24N4 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | N'-[(E)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]quinoline-2-carboximidamide |
| SMILES | CC12CCC(C/C1=N\N=C(/N)c1ccc3ccccc3n1)C2(C)C |
| InChI | InChI=1S/C20H24N4/c1-19(2)14-10-11-20(19,3)17(12-14)23-24-18(21)16-9-8-13-6-4-5-7-15(13)22-16/h4-9,14H,10-12H2,1-3H3,(H2,21,24)/b23-17+ |
| InChIKey | FXOVJCRQRFECGY-HAVVHWLPSA-N |
| XLogP | 4.14 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|