C24H24N4 — CID 170856898
(1R,4E,7S,9S,15R)-4,12-diphenyl-2,6,10,14-tetrazatricyclo[13.1.0.07,9]hexadeca-2,4,10,12-tetraene (PubChem CID 170856898) has the molecular formula C24H24N4 and a molecular weight of 368.48 g/mol. Its IUPAC name is (1R,4E,7S,9S,15R)-4,12-diphenyl-2,6,10,14-tetrazatricyclo[13.1.0.07,9]hexadeca-2,4,10,12-tetraene.
| Compound Name | (1R,4E,7S,9S,15R)-4,12-diphenyl-2,6,10,14-tetrazatricyclo[13.1.0.07,9]hexadeca-2,4,10,12-tetraene |
|---|---|
| PubChem CID | 170856898 |
| Molecular Formula | C24H24N4 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (1R,4E,7S,9S,15R)-4,12-diphenyl-2,6,10,14-tetrazatricyclo[13.1.0.07,9]hexadeca-2,4,10,12-tetraene |
| SMILES | C1=C(c2ccccc2)/C=N/[C@H]2C[C@@H]2N/C=C(c2ccccc2)/C=N/[C@@H]2C[C@H]2N1 |
| InChI | InChI=1S/C24H24N4/c1-3-7-17(8-4-1)19-13-25-21-11-23(21)27-15-20(18-9-5-2-6-10-18)16-28-24-12-22(24)26-14-19/h1-10,13-16,21-25,28H,11-12H2/b19-13-,20-16?,26-14+,27-15+/t21-,22+,23-,24+/m0/s1 |
| InChIKey | ITQNIEHTIJRSKV-OOGAXTJGSA-N |
| XLogP | 3.68 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |