C20H18F3NO — CID 170857137
(1-butylindol-3-yl)-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 170857137) has the molecular formula C20H18F3NO and a molecular weight of 345.36 g/mol. Its IUPAC name is (1-butylindol-3-yl)-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | (1-butylindol-3-yl)-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 170857137 |
| Molecular Formula | C20H18F3NO |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (1-butylindol-3-yl)-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | CCCCn1cc(C(=O)c2ccccc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C20H18F3NO/c1-2-3-12-24-13-16(14-8-5-7-11-18(14)24)19(25)15-9-4-6-10-17(15)20(21,22)23/h4-11,13H,2-3,12H2,1H3 |
| InChIKey | ZPRMHAOWLNOMQS-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |