C28H22N4OS — CID 170857935
methyl 2-cyano-3-oxo-N-phenyl-3-(1-phenyl-4,5-dihydrobenzo[g]indazol-3-yl)propanimidothioate (PubChem CID 170857935) has the molecular formula C28H22N4OS and a molecular weight of 462.58 g/mol. Its IUPAC name is methyl 2-cyano-3-oxo-N-phenyl-3-(1-phenyl-4,5-dihydrobenzo[g]indazol-3-yl)propanimidothioate.
| Compound Name | methyl 2-cyano-3-oxo-N-phenyl-3-(1-phenyl-4,5-dihydrobenzo[g]indazol-3-yl)propanimidothioate |
|---|---|
| PubChem CID | 170857935 |
| Molecular Formula | C28H22N4OS |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | methyl 2-cyano-3-oxo-N-phenyl-3-(1-phenyl-4,5-dihydrobenzo[g]indazol-3-yl)propanimidothioate |
| SMILES | CS/C(=N\c1ccccc1)C(C#N)C(=O)c1nn(-c2ccccc2)c2c1CCc1ccccc1-2 |
| InChI | InChI=1S/C28H22N4OS/c1-34-28(30-20-11-4-2-5-12-20)24(18-29)27(33)25-23-17-16-19-10-8-9-15-22(19)26(23)32(31-25)21-13-6-3-7-14-21/h2-15,24H,16-17H2,1H3/b30-28- |
| InChIKey | QIASFCCSHCNVQM-HYOGKJQXSA-N |
| XLogP | 6.05 |
| TPSA | 71.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|