C34H36N4O12 — CID 170857979
6-[[6-methoxy-7-prop-1-ynyl-3-(3,4,5-trimethoxybenzoyl)indazol-1-yl]methyl-[(5-nitrofuran-2-yl)methoxycarbonyl]amino]hexanoic acid (PubChem CID 170857979) has the molecular formula C34H36N4O12 and a molecular weight of 692.68 g/mol. Its IUPAC name is 6-[[6-methoxy-7-prop-1-ynyl-3-(3,4,5-trimethoxybenzoyl)indazol-1-yl]methyl-[(5-nitrofuran-2-yl)methoxycarbonyl]amino]hexanoic acid.
| Compound Name | 6-[[6-methoxy-7-prop-1-ynyl-3-(3,4,5-trimethoxybenzoyl)indazol-1-yl]methyl-[(5-nitrofuran-2-yl)methoxycarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 170857979 |
| Molecular Formula | C34H36N4O12 |
| Molecular Weight | 692.68 g/mol |
| Exact Mass | 692.23 |
| IUPAC Name | 6-[[6-methoxy-7-prop-1-ynyl-3-(3,4,5-trimethoxybenzoyl)indazol-1-yl]methyl-[(5-nitrofuran-2-yl)methoxycarbonyl]amino]hexanoic acid |
| SMILES | CC#Cc1c(OC)ccc2c(C(=O)c3cc(OC)c(OC)c(OC)c3)nn(CN(CCCCCC(=O)O)C(=O)OCc3ccc([N+](=O)[O-])o3)c12 |
| InChI | InChI=1S/C34H36N4O12/c1-6-10-23-25(45-2)14-13-24-30(32(41)21-17-26(46-3)33(48-5)27(18-21)47-4)35-37(31(23)24)20-36(16-9-7-8-11-29(39)40)34(42)49-19-22-12-15-28(50-22)38(43)44/h12-15,17-18H,7-9,11,16,19-20H2,1-5H3,(H,39,40) |
| InChIKey | PRTRJXFRLVPQAJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 194.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.68 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|