C10H7N3O2 — CID 170859701
2,5-dioxo-3,4-dihydro-1,4-benzodiazepine-1-carbonitrile (PubChem CID 170859701) has the molecular formula C10H7N3O2 and a molecular weight of 201.19 g/mol. Its IUPAC name is 2,5-dioxo-3,4-dihydro-1,4-benzodiazepine-1-carbonitrile.
| Compound Name | 2,5-dioxo-3,4-dihydro-1,4-benzodiazepine-1-carbonitrile |
|---|---|
| PubChem CID | 170859701 |
| Molecular Formula | C10H7N3O2 |
| Molecular Weight | 201.19 g/mol |
| Exact Mass | 201.05 |
| IUPAC Name | 2,5-dioxo-3,4-dihydro-1,4-benzodiazepine-1-carbonitrile |
| SMILES | N#CN1C(=O)CNC(=O)c2ccccc21 |
| InChI | InChI=1S/C10H7N3O2/c11-6-13-8-4-2-1-3-7(8)10(15)12-5-9(13)14/h1-4H,5H2,(H,12,15) |
| InChIKey | LKCUCCDSDVZQIX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|