C10H6F3NO3 — CID 170859899
8-methyl-6-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione (PubChem CID 170859899) has the molecular formula C10H6F3NO3 and a molecular weight of 245.16 g/mol. Its IUPAC name is 8-methyl-6-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione.
| Compound Name | 8-methyl-6-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione |
|---|---|
| PubChem CID | 170859899 |
| Molecular Formula | C10H6F3NO3 |
| Molecular Weight | 245.16 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 8-methyl-6-(trifluoromethyl)-1H-3,1-benzoxazine-2,4-dione |
| SMILES | Cc1cc(C(F)(F)F)cc2c(=O)oc(=O)[nH]c12 |
| InChI | InChI=1S/C10H6F3NO3/c1-4-2-5(10(11,12)13)3-6-7(4)14-9(16)17-8(6)15/h2-3H,1H3,(H,14,16) |
| InChIKey | AGBIWZBRXJLONF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.16 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |