C20H18N2O2 — CID 170859937
2-(2,2-diphenyl-[1,3]dioxolo[4,5-b]pyridin-6-yl)ethanamine (PubChem CID 170859937) has the molecular formula C20H18N2O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-(2,2-diphenyl-[1,3]dioxolo[4,5-b]pyridin-6-yl)ethanamine.
| Compound Name | 2-(2,2-diphenyl-[1,3]dioxolo[4,5-b]pyridin-6-yl)ethanamine |
|---|---|
| PubChem CID | 170859937 |
| Molecular Formula | C20H18N2O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-(2,2-diphenyl-[1,3]dioxolo[4,5-b]pyridin-6-yl)ethanamine |
| SMILES | NCCc1cnc2c(c1)OC(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C20H18N2O2/c21-12-11-15-13-18-19(22-14-15)24-20(23-18,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-10,13-14H,11-12,21H2 |
| InChIKey | CDAQRHDHVJDGGE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |