C13H15F3N2O — CID 170861659
2-(4-methylpiperazin-1-yl)-1-(3,4,5-trifluorophenyl)ethanone (PubChem CID 170861659) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-1-(3,4,5-trifluorophenyl)ethanone.
| Compound Name | 2-(4-methylpiperazin-1-yl)-1-(3,4,5-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 170861659 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-1-(3,4,5-trifluorophenyl)ethanone |
| SMILES | CN1CCN(CC(=O)c2cc(F)c(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H15F3N2O/c1-17-2-4-18(5-3-17)8-12(19)9-6-10(14)13(16)11(15)7-9/h6-7H,2-5,8H2,1H3 |
| InChIKey | FHOIERXNPDDAQM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|