C17H26ClN3O — CID 170862215
2-(4-methylpiperazin-1-yl)-1-(3-pyrrolidin-1-ylphenyl)ethanone;hydrochloride (PubChem CID 170862215) has the molecular formula C17H26ClN3O and a molecular weight of 323.87 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)-1-(3-pyrrolidin-1-ylphenyl)ethanone;hydrochloride.
| Compound Name | 2-(4-methylpiperazin-1-yl)-1-(3-pyrrolidin-1-ylphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 170862215 |
| Molecular Formula | C17H26ClN3O |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)-1-(3-pyrrolidin-1-ylphenyl)ethanone;hydrochloride |
| SMILES | CN1CCN(CC(=O)c2cccc(N3CCCC3)c2)CC1.Cl |
| InChI | InChI=1S/C17H25N3O.ClH/c1-18-9-11-19(12-10-18)14-17(21)15-5-4-6-16(13-15)20-7-2-3-8-20;/h4-6,13H,2-3,7-12,14H2,1H3;1H |
| InChIKey | TUJHHWZHTZOUNW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |