C23H40N4O — CID 170862381
4-methyl-2,6-bis[3-(4-methylpiperazin-1-yl)propyl]phenol (PubChem CID 170862381) has the molecular formula C23H40N4O and a molecular weight of 388.60 g/mol. Its IUPAC name is 4-methyl-2,6-bis[3-(4-methylpiperazin-1-yl)propyl]phenol.
| Compound Name | 4-methyl-2,6-bis[3-(4-methylpiperazin-1-yl)propyl]phenol |
|---|---|
| PubChem CID | 170862381 |
| Molecular Formula | C23H40N4O |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | 4-methyl-2,6-bis[3-(4-methylpiperazin-1-yl)propyl]phenol |
| SMILES | Cc1cc(CCCN2CCN(C)CC2)c(O)c(CCCN2CCN(C)CC2)c1 |
| InChI | InChI=1S/C23H40N4O/c1-20-18-21(6-4-8-26-14-10-24(2)11-15-26)23(28)22(19-20)7-5-9-27-16-12-25(3)13-17-27/h18-19,28H,4-17H2,1-3H3 |
| InChIKey | URKCYAGCOPYCSL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 33.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |