C18H26N2O2 — CID 170863719
[3-[3-(4-methylpiperazin-1-yl)propyl]phenyl] cyclopropanecarboxylate (PubChem CID 170863719) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is [3-[3-(4-methylpiperazin-1-yl)propyl]phenyl] cyclopropanecarboxylate.
| Compound Name | [3-[3-(4-methylpiperazin-1-yl)propyl]phenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 170863719 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | [3-[3-(4-methylpiperazin-1-yl)propyl]phenyl] cyclopropanecarboxylate |
| SMILES | CN1CCN(CCCc2cccc(OC(=O)C3CC3)c2)CC1 |
| InChI | InChI=1S/C18H26N2O2/c1-19-10-12-20(13-11-19)9-3-5-15-4-2-6-17(14-15)22-18(21)16-7-8-16/h2,4,6,14,16H,3,5,7-13H2,1H3 |
| InChIKey | MFTAVIVEQALYRY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|