C21H27N — CID 170865439
N,N-dimethyl-3-(12-tricyclo[9.2.2.14,8]hexadeca-1(13),4(16),5,7,11,14-hexaenyl)propan-1-amine (PubChem CID 170865439) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is N,N-dimethyl-3-(12-tricyclo[9.2.2.14,8]hexadeca-1(13),4(16),5,7,11,14-hexaenyl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(12-tricyclo[9.2.2.14,8]hexadeca-1(13),4(16),5,7,11,14-hexaenyl)propan-1-amine |
|---|---|
| PubChem CID | 170865439 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N,N-dimethyl-3-(12-tricyclo[9.2.2.14,8]hexadeca-1(13),4(16),5,7,11,14-hexaenyl)propan-1-amine |
| SMILES | CN(C)CCCc1cc2ccc1CCc1cccc(c1)CC2 |
| InChI | InChI=1S/C21H27N/c1-22(2)14-4-7-21-16-19-9-8-17-5-3-6-18(15-17)10-12-20(21)13-11-19/h3,5-6,11,13,15-16H,4,7-10,12,14H2,1-2H3 |
| InChIKey | BUPSRKZDJOEDHB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |