About 2-[3-(dimethylamino)propyl]-4,6-difluorophenol
2-[3-(dimethylamino)propyl]-4,6-difluorophenol (PubChem CID 170865567) has the molecular formula C11H15F2NO
and a molecular weight of 215.24 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propyl]-4,6-difluorophenol.
Molecular Properties
| Compound Name | 2-[3-(dimethylamino)propyl]-4,6-difluorophenol |
| PubChem CID | 170865567 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-[3-(dimethylamino)propyl]-4,6-difluorophenol |
| SMILES | CN(C)CCCc1cc(F)cc(F)c1O |
| InChI | InChI=1S/C11H15F2NO/c1-14(2)5-3-4-8-6-9(12)7-10(13)11(8)15/h6-7,15H,3-5H2,1-2H3 |
| InChIKey | IQWMRBGGCAYWCG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[3-(dimethylamino)propyl]-4,6-difluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(dimethylamino)propyl]-4,6-difluorophenol?
The IUPAC name of 2-[3-(dimethylamino)propyl]-4,6-difluorophenol (CID 170865567) is 2-[3-(dimethylamino)propyl]-4,6-difluorophenol.
What is the SMILES notation for 2-[3-(dimethylamino)propyl]-4,6-difluorophenol?
The canonical SMILES for 2-[3-(dimethylamino)propyl]-4,6-difluorophenol is CN(C)CCCc1cc(F)cc(F)c1O.
What is the InChIKey of 2-[3-(dimethylamino)propyl]-4,6-difluorophenol?
The InChIKey is IQWMRBGGCAYWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO/c1-14(2)5-3-4-8-6-9(12)7-10(13)11(8)15/h6-7,15H,3-5H2,1-2H3.
What are the key properties of 2-[3-(dimethylamino)propyl]-4,6-difluorophenol?
2-[3-(dimethylamino)propyl]-4,6-difluorophenol has a molecular weight of 215.24 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(dimethylamino)propyl]-4,6-difluorophenol is sourced from PubChem (CID 170865567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).