C15H25NO — CID 170866592
N,N-dimethyl-3-(5-methyl-2-propoxyphenyl)propan-1-amine (PubChem CID 170866592) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N,N-dimethyl-3-(5-methyl-2-propoxyphenyl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(5-methyl-2-propoxyphenyl)propan-1-amine |
|---|---|
| PubChem CID | 170866592 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N,N-dimethyl-3-(5-methyl-2-propoxyphenyl)propan-1-amine |
| SMILES | CCCOc1ccc(C)cc1CCCN(C)C |
| InChI | InChI=1S/C15H25NO/c1-5-11-17-15-9-8-13(2)12-14(15)7-6-10-16(3)4/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | FREVIVPMBXJKQN-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |