About 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine
3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine (PubChem CID 170866731) has the molecular formula C20H24N2
and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 170866731 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1ccc2ccn(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C20H24N2/c1-21(2)13-6-9-17-10-11-19-12-14-22(20(19)15-17)16-18-7-4-3-5-8-18/h3-5,7-8,10-12,14-15H,6,9,13,16H2,1-2H3 |
| InChIKey | DEIZOXZACQIOEN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine (CID 170866731) is 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine is CN(C)CCCc1ccc2ccn(Cc3ccccc3)c2c1.
What is the InChIKey of 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine?
The InChIKey is DEIZOXZACQIOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2/c1-21(2)13-6-9-17-10-11-19-12-14-22(20(19)15-17)16-18-7-4-3-5-8-18/h3-5,7-8,10-12,14-15H,6,9,13,16H2,1-2H3.
What are the key properties of 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine?
3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine has a molecular weight of 292.43 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-benzylindol-6-yl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 170866731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).