C15H19NOS — CID 170867177
N,N-dimethyl-3-(3-phenoxythiophen-2-yl)propan-1-amine (PubChem CID 170867177) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-phenoxythiophen-2-yl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(3-phenoxythiophen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 170867177 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N,N-dimethyl-3-(3-phenoxythiophen-2-yl)propan-1-amine |
| SMILES | CN(C)CCCc1sccc1Oc1ccccc1 |
| InChI | InChI=1S/C15H19NOS/c1-16(2)11-6-9-15-14(10-12-18-15)17-13-7-4-3-5-8-13/h3-5,7-8,10,12H,6,9,11H2,1-2H3 |
| InChIKey | CZSKWSCEDUQNBT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |