C18H23NO3 — CID 170867828
3-[3-methoxy-4-[(3-methoxyphenyl)methoxy]phenyl]propan-1-amine (PubChem CID 170867828) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-[3-methoxy-4-[(3-methoxyphenyl)methoxy]phenyl]propan-1-amine.
| Compound Name | 3-[3-methoxy-4-[(3-methoxyphenyl)methoxy]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 170867828 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-[3-methoxy-4-[(3-methoxyphenyl)methoxy]phenyl]propan-1-amine |
| SMILES | COc1cccc(COc2ccc(CCCN)cc2OC)c1 |
| InChI | InChI=1S/C18H23NO3/c1-20-16-7-3-5-15(11-16)13-22-17-9-8-14(6-4-10-19)12-18(17)21-2/h3,5,7-9,11-12H,4,6,10,13,19H2,1-2H3 |
| InChIKey | AHEJQMRMXTXUBD-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |