C20H34N2O5 — CID 170868542
2-[4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)phenyl]ethanamine (PubChem CID 170868542) has the molecular formula C20H34N2O5 and a molecular weight of 382.50 g/mol. Its IUPAC name is 2-[4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)phenyl]ethanamine.
| Compound Name | 2-[4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 170868542 |
| Molecular Formula | C20H34N2O5 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | 2-[4-(1,4,7,10,13-pentaoxa-16-azacyclooctadec-16-yl)phenyl]ethanamine |
| SMILES | NCCc1ccc(N2CCOCCOCCOCCOCCOCC2)cc1 |
| InChI | InChI=1S/C20H34N2O5/c21-6-5-19-1-3-20(4-2-19)22-7-9-23-11-13-25-15-17-27-18-16-26-14-12-24-10-8-22/h1-4H,5-18,21H2 |
| InChIKey | FOSQOFRJOYSSLS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 75.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|