C11H13N3O — CID 170868647
2-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]ethanamine (PubChem CID 170868647) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 2-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]ethanamine.
| Compound Name | 2-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 170868647 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 2-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]ethanamine |
| SMILES | Cc1nc(-c2cccc(CCN)c2)no1 |
| InChI | InChI=1S/C11H13N3O/c1-8-13-11(14-15-8)10-4-2-3-9(7-10)5-6-12/h2-4,7H,5-6,12H2,1H3 |
| InChIKey | QUBQURGHWIAWDQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |