C12H16N2O2 — CID 170868919
1-[3-(2-aminoethyl)indol-1-yl]ethane-1,2-diol (PubChem CID 170868919) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)indol-1-yl]ethane-1,2-diol.
| Compound Name | 1-[3-(2-aminoethyl)indol-1-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 170868919 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | 1-[3-(2-aminoethyl)indol-1-yl]ethane-1,2-diol |
| SMILES | NCCc1cn(C(O)CO)c2ccccc12 |
| InChI | InChI=1S/C12H16N2O2/c13-6-5-9-7-14(12(16)8-15)11-4-2-1-3-10(9)11/h1-4,7,12,15-16H,5-6,8,13H2 |
| InChIKey | WMBDIWRFFJROMT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |