C13H12ClNOS — CID 170868982
2-(8-chloro-4H-thieno[3,2-c]chromen-2-yl)ethanamine (PubChem CID 170868982) has the molecular formula C13H12ClNOS and a molecular weight of 265.76 g/mol. Its IUPAC name is 2-(8-chloro-4H-thieno[3,2-c]chromen-2-yl)ethanamine.
| Compound Name | 2-(8-chloro-4H-thieno[3,2-c]chromen-2-yl)ethanamine |
|---|---|
| PubChem CID | 170868982 |
| Molecular Formula | C13H12ClNOS |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 2-(8-chloro-4H-thieno[3,2-c]chromen-2-yl)ethanamine |
| SMILES | NCCc1cc2c(s1)-c1cc(Cl)ccc1OC2 |
| InChI | InChI=1S/C13H12ClNOS/c14-9-1-2-12-11(6-9)13-8(7-16-12)5-10(17-13)3-4-15/h1-2,5-6H,3-4,7,15H2 |
| InChIKey | DPOZGZNUHAEJEZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |