C19H22FNO — CID 170869953
4-[3-[2-(2-fluorophenyl)phenyl]propyl]morpholine (PubChem CID 170869953) has the molecular formula C19H22FNO and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[3-[2-(2-fluorophenyl)phenyl]propyl]morpholine.
| Compound Name | 4-[3-[2-(2-fluorophenyl)phenyl]propyl]morpholine |
|---|---|
| PubChem CID | 170869953 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 4-[3-[2-(2-fluorophenyl)phenyl]propyl]morpholine |
| SMILES | Fc1ccccc1-c1ccccc1CCCN1CCOCC1 |
| InChI | InChI=1S/C19H22FNO/c20-19-10-4-3-9-18(19)17-8-2-1-6-16(17)7-5-11-21-12-14-22-15-13-21/h1-4,6,8-10H,5,7,11-15H2 |
| InChIKey | WMIWVUJSVPGOCI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |