About 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine
4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine (PubChem CID 170871146) has the molecular formula C13H23NOS
and a molecular weight of 241.40 g/mol. Its IUPAC name is 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine.
Molecular Properties
| Compound Name | 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine |
| PubChem CID | 170871146 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine |
| SMILES | CC1=CC(CCCN2CCOCC2)C(C)S1 |
| InChI | InChI=1S/C13H23NOS/c1-11-10-13(12(2)16-11)4-3-5-14-6-8-15-9-7-14/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | UVQXCHVTYCEGOT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine?
The IUPAC name of 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine (CID 170871146) is 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine.
What is the SMILES notation for 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine?
The canonical SMILES for 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine is CC1=CC(CCCN2CCOCC2)C(C)S1.
What is the InChIKey of 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine?
The InChIKey is UVQXCHVTYCEGOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NOS/c1-11-10-13(12(2)16-11)4-3-5-14-6-8-15-9-7-14/h10,12-13H,3-9H2,1-2H3.
What are the key properties of 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine?
4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine has a molecular weight of 241.40 g/mol, XLogP of 2.75, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,5-dimethyl-2,3-dihydrothiophen-3-yl)propyl]morpholine is sourced from PubChem (CID 170871146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).