C10H7ClF2O2 — CID 170873440
(E)-3-(4-chloro-2,6-difluorophenyl)-2-methylprop-2-enoic acid (PubChem CID 170873440) has the molecular formula C10H7ClF2O2 and a molecular weight of 232.61 g/mol. Its IUPAC name is (E)-3-(4-chloro-2,6-difluorophenyl)-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-(4-chloro-2,6-difluorophenyl)-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 170873440 |
| Molecular Formula | C10H7ClF2O2 |
| Molecular Weight | 232.61 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (E)-3-(4-chloro-2,6-difluorophenyl)-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1c(F)cc(Cl)cc1F)C(=O)O |
| InChI | InChI=1S/C10H7ClF2O2/c1-5(10(14)15)2-7-8(12)3-6(11)4-9(7)13/h2-4H,1H3,(H,14,15)/b5-2+ |
| InChIKey | REYFAPZMMBUCLI-GORDUTHDSA-N |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|