C14H11Cl2N3O4S — CID 170873693
(E)-3-[(4-chloro-6-methylpyrimidin-2-yl)amino]-2-(4-chlorophenyl)sulfonylprop-2-enoic acid (PubChem CID 170873693) has the molecular formula C14H11Cl2N3O4S and a molecular weight of 388.23 g/mol. Its IUPAC name is (E)-3-[(4-chloro-6-methylpyrimidin-2-yl)amino]-2-(4-chlorophenyl)sulfonylprop-2-enoic acid.
| Compound Name | (E)-3-[(4-chloro-6-methylpyrimidin-2-yl)amino]-2-(4-chlorophenyl)sulfonylprop-2-enoic acid |
|---|---|
| PubChem CID | 170873693 |
| Molecular Formula | C14H11Cl2N3O4S |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 386.98 |
| IUPAC Name | (E)-3-[(4-chloro-6-methylpyrimidin-2-yl)amino]-2-(4-chlorophenyl)sulfonylprop-2-enoic acid |
| SMILES | Cc1cc(Cl)nc(N/C=C(\C(=O)O)S(=O)(=O)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C14H11Cl2N3O4S/c1-8-6-12(16)19-14(18-8)17-7-11(13(20)21)24(22,23)10-4-2-9(15)3-5-10/h2-7H,1H3,(H,20,21)(H,17,18,19)/b11-7+ |
| InChIKey | IFZGUTCRMKFYGF-YRNVUSSQSA-N |
| XLogP | 2.90 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|