About ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate
ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate (PubChem CID 170874265) has the molecular formula C14H13Cl2NO4
and a molecular weight of 330.17 g/mol. Its IUPAC name is ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate |
| PubChem CID | 170874265 |
| Molecular Formula | C14H13Cl2NO4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1C1OCCO1 |
| InChI | InChI=1S/C14H13Cl2NO4/c1-2-19-13(18)12-11(14-20-3-4-21-14)10-8(16)5-7(15)6-9(10)17-12/h5-6,14,17H,2-4H2,1H3 |
| InChIKey | AAPONWSUEXNGCH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate?
The IUPAC name of ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate (CID 170874265) is ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate.
What is the SMILES notation for ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate?
The canonical SMILES for ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate is CCOC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1C1OCCO1.
What is the InChIKey of ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate?
The InChIKey is AAPONWSUEXNGCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2NO4/c1-2-19-13(18)12-11(14-20-3-4-21-14)10-8(16)5-7(15)6-9(10)17-12/h5-6,14,17H,2-4H2,1H3.
What are the key properties of ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate?
ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate has a molecular weight of 330.17 g/mol, XLogP of 3.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4,6-dichloro-3-(1,3-dioxolan-2-yl)-1H-indole-2-carboxylate is sourced from PubChem (CID 170874265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).