About 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol
3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol (PubChem CID 170875141) has the molecular formula C11H14N2OS2
and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol |
| PubChem CID | 170875141 |
| Molecular Formula | C11H14N2OS2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol |
| SMILES | Cc1nc(-c2ccc(C(N)CCO)s2)cs1 |
| InChI | InChI=1S/C11H14N2OS2/c1-7-13-9(6-15-7)11-3-2-10(16-11)8(12)4-5-14/h2-3,6,8,14H,4-5,12H2,1H3 |
| InChIKey | PAXDTRUNIRKFFS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol?
The IUPAC name of 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol (CID 170875141) is 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol.
What is the SMILES notation for 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol?
The canonical SMILES for 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol is Cc1nc(-c2ccc(C(N)CCO)s2)cs1.
What is the InChIKey of 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol?
The InChIKey is PAXDTRUNIRKFFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS2/c1-7-13-9(6-15-7)11-3-2-10(16-11)8(12)4-5-14/h2-3,6,8,14H,4-5,12H2,1H3.
What are the key properties of 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol?
3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol has a molecular weight of 254.38 g/mol, XLogP of 2.56, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-[5-(2-methyl-1,3-thiazol-4-yl)thiophen-2-yl]propan-1-ol is sourced from PubChem (CID 170875141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).