About [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine
[2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine (PubChem CID 170875415) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine |
| PubChem CID | 170875415 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine |
| SMILES | NCc1cccnc1N1CCCNCC1 |
| InChI | InChI=1S/C11H18N4/c12-9-10-3-1-5-14-11(10)15-7-2-4-13-6-8-15/h1,3,5,13H,2,4,6-9,12H2 |
| InChIKey | CYOKTYDOPKOPRL-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine?
The IUPAC name of [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine (CID 170875415) is [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine.
What is the SMILES notation for [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine?
The canonical SMILES for [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine is NCc1cccnc1N1CCCNCC1.
What is the InChIKey of [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine?
The InChIKey is CYOKTYDOPKOPRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4/c12-9-10-3-1-5-14-11(10)15-7-2-4-13-6-8-15/h1,3,5,13H,2,4,6-9,12H2.
What are the key properties of [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine?
[2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine has a molecular weight of 206.29 g/mol, XLogP of 0.34, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,4-diazepan-1-yl)-3-pyridinyl]methanamine is sourced from PubChem (CID 170875415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).